Structure of PDB 5y95 Chain A Binding Site BS01 |
|
|
Ligand ID | 8TL |
InChI | InChI=1S/C20H35N3O5S/c1-7-16-19(25)22-15(9-11-29-6)18(24)21(10-8-13(2)3)12-17(22)23(28-16)20(26)27-14(4)5/h13-17H,7-12H2,1-6H3/t15-,16+,17-/m0/s1 |
InChIKey | WWMMWXUYOOJAEO-BBWFWOEESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC[CH]1ON([CH]2CN(CCC(C)C)C(=O)[CH](CCSC)N2C1=O)C(=O)OC(C)C | OpenEye OEToolkits 2.0.6 | CC[C@@H]1C(=O)N2[C@H](CN(C(=O)[C@@H]2CCSC)CCC(C)C)N(O1)C(=O)OC(C)C | OpenEye OEToolkits 2.0.6 | CCC1C(=O)N2C(CN(C(=O)C2CCSC)CCC(C)C)N(O1)C(=O)OC(C)C | CACTVS 3.385 | CC[C@H]1ON([C@H]2CN(CCC(C)C)C(=O)[C@H](CCSC)N2C1=O)C(=O)OC(C)C |
|
Formula | C20 H35 N3 O5 S |
Name | propan-2-yl (3R,6S,9aS)-3-ethyl-8-(3-methylbutyl)-6-(2-methylsulfanylethyl)-4,7-bis(oxidanylidene)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate |
ChEMBL | CHEMBL4069005 |
DrugBank | |
ZINC |
|
PDB chain | 5y95 Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|