Structure of PDB 5y41 Chain A Binding Site BS01 |
|
|
Ligand ID | RPG |
InChI | InChI=1S/C20H32O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h12-18,21H,2-11H2,1H3,(H,23,24)/b14-12+/t16-,17-,18+/m0/s1 |
InChIKey | BGKHCLZFGPIKKU-LDDQNKHRSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCCCCC(C=CC1C=CC(=O)C1CCCCCCC(=O)O)O | CACTVS 3.385 | CCCCC[C@H](O)\C=C\[C@H]1C=CC(=O)[C@@H]1CCCCCCC(O)=O | OpenEye OEToolkits 2.0.6 | CCCCC[C@@H](/C=C/[C@H]1C=CC(=O)[C@@H]1CCCCCCC(=O)O)O | CACTVS 3.385 | CCCCC[CH](O)C=C[CH]1C=CC(=O)[CH]1CCCCCCC(O)=O |
|
Formula | C20 H32 O4 |
Name | (13E,15S)-15-hydroxy-9-oxoprosta-10,13-dien-1-oic acid; PROSTAGLANDIN A1 (PGA1) |
ChEMBL | CHEMBL1084644 |
DrugBank | |
ZINC | ZINC000004096507
|
PDB chain | 5y41 Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|