Structure of PDB 5xz7 Chain A Binding Site BS01 |
|
|
Ligand ID | F6P |
InChI | InChI=1S/C6H13O9P/c7-2-6(10)5(9)4(8)3(15-6)1-14-16(11,12)13/h3-5,7-10H,1-2H2,(H2,11,12,13)/t3-,4-,5+,6-/m1/s1 |
InChIKey | BGWGXPAPYGQALX-ARQDHWQXSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=P(O)(O)OCC1OC(O)(CO)C(O)C1O | OpenEye OEToolkits 1.5.0 | C(C1C(C(C(O1)(CO)O)O)O)OP(=O)(O)O | OpenEye OEToolkits 1.5.0 | C([C@@H]1[C@H]([C@@H]([C@](O1)(CO)O)O)O)OP(=O)(O)O | CACTVS 3.341 | OC[C]1(O)O[CH](CO[P](O)(O)=O)[CH](O)[CH]1O | CACTVS 3.341 | OC[C@@]1(O)O[C@H](CO[P](O)(O)=O)[C@@H](O)[C@@H]1O |
|
Formula | C6 H13 O9 P |
Name | 6-O-phosphono-beta-D-fructofuranose; FRUCTOSE-6-PHOSPHATE; 6-O-phosphono-beta-D-fructose; 6-O-phosphono-D-fructose; 6-O-phosphono-fructose |
ChEMBL | CHEMBL604196 |
DrugBank | |
ZINC | ZINC000004096690
|
PDB chain | 5xz7 Chain A Residue 407
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.1.11: 6-phosphofructokinase. |
|
|
|