Structure of PDB 5xxh Chain A Binding Site BS01 |
|
|
Ligand ID | E0D |
InChI | InChI=1S/C18H20N2O4/c1-12(21)15-10-20(16-7-3-2-6-14(15)16)11-17(22)19-8-4-5-13(9-19)18(23)24/h2-3,6-7,10,13H,4-5,8-9,11H2,1H3,(H,23,24)/t13-/m0/s1 |
InChIKey | ZYTILVPFRSHVDL-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(=O)c1cn(CC(=O)N2CCC[CH](C2)C(O)=O)c3ccccc13 | OpenEye OEToolkits 2.0.6 | CC(=O)c1cn(c2c1cccc2)CC(=O)N3CCCC(C3)C(=O)O | CACTVS 3.385 | CC(=O)c1cn(CC(=O)N2CCC[C@@H](C2)C(O)=O)c3ccccc13 | OpenEye OEToolkits 2.0.6 | CC(=O)c1cn(c2c1cccc2)CC(=O)N3CCC[C@@H](C3)C(=O)O |
|
Formula | C18 H20 N2 O4 |
Name | (3S)-1-[2-(3-ethanoylindol-1-yl)ethanoyl]piperidine-3-carboxylic acid |
ChEMBL | CHEMBL4161161 |
DrugBank | |
ZINC | ZINC000036365331
|
PDB chain | 5xxh Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|