Structure of PDB 5xpi Chain A Binding Site BS01 |
|
|
Ligand ID | 8C3 |
InChI | InChI=1S/C18H25N5O2S/c1-4-21(5-2)9-6-8-19-17(24)12-22-18(25)15-11-16-14(7-10-26-16)23(15)13(3)20-22/h7,10-11H,4-6,8-9,12H2,1-3H3,(H,19,24) |
InChIKey | DRDIHUMOFDGYRJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCN(CC)CCCNC(=O)CN1N=C(C)n2c3ccsc3cc2C1=O | OpenEye OEToolkits 2.0.6 | CCN(CC)CCCNC(=O)CN1C(=O)c2cc3c(n2C(=N1)C)ccs3 |
|
Formula | C18 H25 N5 O2 S |
Name | N-[3-(diethylamino)propyl]-2-(12-methyl-9-oxidanylidene-5-thia-1,10,11-triazatricyclo[6.4.0.0^2,6]dodeca-2(6),3,7,11-tetraen-10-yl)ethanamide |
ChEMBL | CHEMBL2141272 |
DrugBank | |
ZINC | ZINC000005108717
|
PDB chain | 5xpi Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.3.2.27: RING-type E3 ubiquitin transferase. |
|
|