Structure of PDB 5x2z Chain A Binding Site BS01 |
|
|
Ligand ID | 3LM |
InChI | InChI=1S/C13H19N2O7PS/c1-8-12(16)10(6-15-11(13(17)18)3-4-24-2)9(5-14-8)7-22-23(19,20)21/h3,5,15-16H,4,6-7H2,1-2H3,(H,17,18)(H2,19,20,21)/b11-3+ |
InChIKey | LPFNPHQQDYAHKU-QDEBKDIKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CSCC=C(NCc1c(O)c(C)ncc1CO[P](O)(O)=O)C(O)=O | OpenEye OEToolkits 1.7.0 | Cc1c(c(c(cn1)COP(=O)(O)O)CNC(=CCSC)C(=O)O)O | OpenEye OEToolkits 1.7.0 | Cc1c(c(c(cn1)COP(=O)(O)O)CN/C(=C/CSC)/C(=O)O)O | CACTVS 3.370 | CSC\C=C(NCc1c(O)c(C)ncc1CO[P](O)(O)=O)/C(O)=O | ACDLabs 12.01 | O=P(O)(O)OCc1cnc(c(O)c1CNC(=C/CSC)/C(=O)O)C |
|
Formula | C13 H19 N2 O7 P S |
Name | (2E)-2-[({3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}methyl)amino]-4-(methylsulfanyl)but-2-enoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000103526166
|
PDB chain | 5x2z Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|