Structure of PDB 5wr1 Chain A Binding Site BS01 |
|
|
Ligand ID | 8XO |
InChI | InChI=1S/C18H30N4O3/c19-22-21-14-12-10-8-6-4-2-1-3-5-7-9-11-13-17(23)15-20-16-18(24)25/h11,13,15H,1-10,12,14,16H2,(H,24,25)/b13-11+,20-15+ |
InChIKey | VMJXHBQSQBKHEB-PZBCRXGTSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | C(CCCCCCN=[N+]=[N-])CCCCC/C=C/C(=O)/C=N/CC(=O)O | CACTVS 3.385 | OC(=O)CN=CC(=O)C=CCCCCCCCCCCCCN=[N+]=[N-] | CACTVS 3.385 | OC(=O)CN=CC(=O)/C=C/CCCCCCCCCCCCN=[N+]=[N-] | OpenEye OEToolkits 2.0.6 | C(CCCCCCN=[N+]=[N-])CCCCCC=CC(=O)C=NCC(=O)O |
|
Formula | C18 H30 N4 O3 |
Name | 2-[E-(E-16-azido-2-oxidanylidene-hexadec-3-enylidene)amino]ethanoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5wr1 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|