Structure of PDB 5wo4 Chain A Binding Site BS01 |
|
|
Ligand ID | B7V |
InChI | InChI=1S/C17H18ClN5O3/c1-25-15-6-11(2-3-13(15)18)21-17-12(16(20)24)8-23(22-17)14-9-26-5-4-10(14)7-19/h2-3,6,8,10,14H,4-5,9H2,1H3,(H2,20,24)(H,21,22)/t10-,14+/m1/s1 |
InChIKey | MFWQXZZXOUIDTN-YGRLFVJLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | COc1cc(ccc1Cl)Nc2c(cn(n2)C3COCCC3C#N)C(=O)N | OpenEye OEToolkits 2.0.6 | COc1cc(ccc1Cl)Nc2c(cn(n2)[C@H]3COCC[C@@H]3C#N)C(=O)N | CACTVS 3.385 | COc1cc(Nc2nn(cc2C(N)=O)[C@H]3COCC[C@@H]3C#N)ccc1Cl | ACDLabs 12.01 | C(c2cn(C1C(CCOC1)C#N)nc2Nc3cc(OC)c(cc3)Cl)(N)=O | CACTVS 3.385 | COc1cc(Nc2nn(cc2C(N)=O)[CH]3COCC[CH]3C#N)ccc1Cl |
|
Formula | C17 H18 Cl N5 O3 |
Name | 3-[(4-chloro-3-methoxyphenyl)amino]-1-[(3R,4S)-4-cyanooxan-3-yl]-1H-pyrazole-4-carboxamide |
ChEMBL | CHEMBL4071005 |
DrugBank | |
ZINC |
|
PDB chain | 5wo4 Chain A Residue 2001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|