Structure of PDB 5wnk Chain A Binding Site BS01 |
|
|
Ligand ID | B6J |
InChI | InChI=1S/C18H14N6O2/c19-16-15-17(24-18(20)23-16)22-14(10-4-2-6-12(26)8-10)13(21-15)9-3-1-5-11(25)7-9/h1-8,25-26H,(H4,19,20,22,23,24) |
InChIKey | UJIAQDJKSXQLIT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Nc1nc(N)c2nc(c3cccc(O)c3)c(nc2n1)c4cccc(O)c4 | OpenEye OEToolkits 2.0.6 | c1cc(cc(c1)O)c2c(nc3c(n2)c(nc(n3)N)N)c4cccc(c4)O | ACDLabs 12.01 | c1c(cccc1c4c(c2cccc(O)c2)nc3c(c(nc(n3)N)N)n4)O |
|
Formula | C18 H14 N6 O2 |
Name | 3,3'-(2,4-diaminopteridine-6,7-diyl)diphenol |
ChEMBL | CHEMBL230011 |
DrugBank | DB05552 |
ZINC | ZINC000006718666
|
PDB chain | 5wnk Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|