Structure of PDB 5wbq Chain A Binding Site BS01 |
|
|
Ligand ID | A3J |
InChI | InChI=1S/C16H17F3N4O/c1-3-9-6-11-12(21-9)13(23-5-4-15(2,24)8-23)10(7-20)14(22-11)16(17,18)19/h6,21,24H,3-5,8H2,1-2H3/t15-/m0/s1 |
InChIKey | PSWIJUOHBAWLCU-HNNXBMFYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCc1cc2c([nH]1)c(c(c(n2)C(F)(F)F)C#N)N3CC[C@](C3)(C)O | CACTVS 3.385 | CCc1[nH]c2c(c1)nc(c(C#N)c2N3CC[C@](C)(O)C3)C(F)(F)F | ACDLabs 12.01 | N#Cc1c(c2nc(cc2nc1C(F)(F)F)CC)N3CCC(C)(C3)O | OpenEye OEToolkits 2.0.6 | CCc1cc2c([nH]1)c(c(c(n2)C(F)(F)F)C#N)N3CCC(C3)(C)O | CACTVS 3.385 | CCc1[nH]c2c(c1)nc(c(C#N)c2N3CC[C](C)(O)C3)C(F)(F)F |
|
Formula | C16 H17 F3 N4 O |
Name | 2-ethyl-7-[(3S)-3-hydroxy-3-methylpyrrolidin-1-yl]-5-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine-6-carbonitrile |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5wbq Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|