Structure of PDB 5w8k Chain A Binding Site BS01 |
|
|
Ligand ID | 9Y7 |
InChI | InChI=1S/C20H14F2N4O5S2/c21-14-6-3-11(8-15(14)22)17-13(7-10-1-4-12(5-2-10)33(23,30)31)18(27)26(25-17)20-24-16(9-32-20)19(28)29/h1-6,8-9,27H,7H2,(H,28,29)(H2,23,30,31) |
InChIKey | HADCVZAHKWNLJA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1cc(ccc1Cc2c(nn(c2O)c3nc(cs3)C(=O)O)c4ccc(c(c4)F)F)S(=O)(=O)N | ACDLabs 12.01 | c2(Cc1ccc(S(N)(=O)=O)cc1)c(O)n(nc2c3cc(c(cc3)F)F)c4scc(n4)C(=O)O | CACTVS 3.385 | N[S](=O)(=O)c1ccc(Cc2c(O)n(nc2c3ccc(F)c(F)c3)c4scc(n4)C(O)=O)cc1 |
|
Formula | C20 H14 F2 N4 O5 S2 |
Name | 2-{3-(3,4-difluorophenyl)-5-hydroxy-4-[(4-sulfamoylphenyl)methyl]-1H-pyrazol-1-yl}-1,3-thiazole-4-carboxylic acid |
ChEMBL | CHEMBL4076973 |
DrugBank | |
ZINC |
|
PDB chain | 5w8k Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D165 R168 H192 |
Catalytic site (residue number reindexed from 1) |
D157 R160 H184 |
Enzyme Commision number |
1.1.1.27: L-lactate dehydrogenase. |
|
|
|