Structure of PDB 5w1o Chain A Binding Site BS01 |
|
|
Ligand ID | JHM |
InChI | InChI=1S/C6H12O8S/c7-3-1-5(8)14-4(6(3)9)2-13-15(10,11)12/h3-9H,1-2H2,(H,10,11,12)/t3-,4-,5+,6+/m1/s1 |
InChIKey | GDISEEDIIABUSR-ZXXMMSQZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | C1C(C(C(OC1O)COS(=O)(=O)O)O)O | OpenEye OEToolkits 1.7.0 | C1[C@H]([C@@H]([C@H](O[C@@H]1O)COS(=O)(=O)O)O)O | CACTVS 3.370 | O[CH]1C[CH](O)[CH](O)[CH](CO[S](O)(=O)=O)O1 | ACDLabs 12.01 | O=S(=O)(O)OCC1OC(O)CC(O)C1O | CACTVS 3.370 | O[C@@H]1C[C@@H](O)[C@H](O)[C@@H](CO[S](O)(=O)=O)O1 |
|
Formula | C6 H12 O8 S |
Name | 2-deoxy-6-O-sulfo-alpha-D-glucopyranose; 2-deoxy-6-O-sulfo-alpha-D-arabino-hexopyranose; 2-deoxy-6-O-sulfo-alpha-D-glucose; 2-deoxy-6-O-sulfo-D-glucose; 2-deoxy-6-O-sulfo-glucose |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058650367
|
PDB chain | 5w1o Chain G Residue 3
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|