Structure of PDB 5w14 Chain A Binding Site BS01 |
|
|
Ligand ID | 9TJ |
InChI | InChI=1S/C17H17BN4O5S/c23-16(8-13-5-2-6-28-13)19-15(18(26)27)10-22-9-14(20-21-22)11-3-1-4-12(7-11)17(24)25/h1-7,9,15,26-27H,8,10H2,(H,19,23)(H,24,25)/t15-/m0/s1 |
InChIKey | WHXOLIBPKXZPTN-HNNXBMFYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | B(C(Cn1cc(nn1)c2cccc(c2)C(=O)O)NC(=O)Cc3cccs3)(O)O | ACDLabs 12.01 | C(B(O)O)(Cn2cc(c1cccc(c1)C(O)=O)nn2)NC(=O)Cc3sccc3 | CACTVS 3.385 | OB(O)[CH](Cn1cc(nn1)c2cccc(c2)C(O)=O)NC(=O)Cc3sccc3 | CACTVS 3.385 | OB(O)[C@H](Cn1cc(nn1)c2cccc(c2)C(O)=O)NC(=O)Cc3sccc3 | OpenEye OEToolkits 2.0.6 | B([C@H](Cn1cc(nn1)c2cccc(c2)C(=O)O)NC(=O)Cc3cccs3)(O)O |
|
Formula | C17 H17 B N4 O5 S |
Name | 3-{1-[(2R)-2-borono-2-{[(thiophen-2-yl)acetyl]amino}ethyl]-1H-1,2,3-triazol-4-yl}benzoic acid; boronic acid transition state inhibitor S03043 |
ChEMBL | CHEMBL3586556 |
DrugBank | |
ZINC | ZINC000205341683
|
PDB chain | 5w14 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|