Structure of PDB 5vwo Chain A Binding Site BS01 |
|
|
Ligand ID | 9QJ |
InChI | InChI=1S/C14H19N2O7P/c1-7-13(17)11(10(5-16-7)6-23-24(20,21)22)3-8-2-9(14(18)19)4-12(8)15/h5,8-9,15,17H,2-4,6H2,1H3,(H,18,19)(H2,20,21,22)/b15-12+/t8-,9-/m0/s1 |
InChIKey | CTOWFYUCLIAQOJ-QEPOKVMRSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c(C[CH]2C[CH](CC2=N)C(O)=O)c1O | OpenEye OEToolkits 2.0.6 | [H]/N=C/1\C[C@H](C[C@H]1Cc2c(cnc(c2O)C)COP(=O)(O)O)C(=O)O | CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c(C[C@@H]2C[C@@H](CC2=N)C(O)=O)c1O | ACDLabs 12.01 | C(c1c(O)c(C)ncc1COP(O)(O)=O)C2\C(=N)CC(C2)C(O)=O | OpenEye OEToolkits 2.0.6 | Cc1c(c(c(cn1)COP(=O)(O)O)CC2CC(CC2=N)C(=O)O)O |
|
Formula | C14 H19 N2 O7 P |
Name | (1S,3S,4E)-3-({3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}methyl)-4-iminocyclopentane-1-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5vwo Chain A Residue 500
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|