Structure of PDB 5vwg Chain A Binding Site BS01 |
|
|
Ligand ID | 9QG |
InChI | InChI=1S/C10H18O8/c1-4(9(14)15)17-8-6(12)5(3-11)18-10(16-2)7(8)13/h4-8,10-13H,3H2,1-2H3,(H,14,15)/t4-,5-,6+,7-,8+,10-/m1/s1 |
InChIKey | PXMURYZLIUEKLA-BEESJRNYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | C[C@H](C(=O)O)O[C@H]1[C@H]([C@H](O[C@H]([C@@H]1O)OC)CO)O | OpenEye OEToolkits 2.0.6 | CC(C(=O)O)OC1C(C(OC(C1O)OC)CO)O | CACTVS 3.385 | CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O[C@H](C)C(O)=O)[C@H]1O | CACTVS 3.385 | CO[CH]1O[CH](CO)[CH](O)[CH](O[CH](C)C(O)=O)[CH]1O | ACDLabs 12.01 | O(C)C1OC(CO)C(C(C1O)OC(C(O)=O)C)O |
|
Formula | C10 H18 O8 |
Name | methyl 3-O-[(1R)-1-carboxyethyl]-beta-D-galactopyranoside; methyl 3-O-[(1R)-1-carboxyethyl]-beta-D-galactoside; methyl 3-O-[(1R)-1-carboxyethyl]-D-galactoside; methyl 3-O-[(1R)-1-carboxyethyl]-galactoside |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5vwg Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|