Structure of PDB 5vrl Chain A Binding Site BS01 |
|
|
Ligand ID | 9JA |
InChI | InChI=1S/C17H18BF3N3O6S/c1-2-31(28,29)24-18(25,26)15-8-14(5-3-11(15)9-22-24)30-16-6-4-13(17(19,20)21)7-12(16)10-23-27/h3-8,10,22,25-27H,2,9H2,1H3/b23-10+ |
InChIKey | MTDIXAKABVYTBV-AUEPDCJTSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | B1(c2cc(ccc2CNN1S(=O)(=O)CC)Oc3ccc(cc3C=NO)C(F)(F)F)(O)O | CACTVS 3.385 | CC[S](=O)(=O)N1NCc2ccc(Oc3ccc(cc3\C=N\O)C(F)(F)F)cc2[B]1(O)O | OpenEye OEToolkits 2.0.6 | B1(c2cc(ccc2CNN1S(=O)(=O)CC)Oc3ccc(cc3/C=N/O)C(F)(F)F)(O)O | CACTVS 3.385 | CC[S](=O)(=O)N1NCc2ccc(Oc3ccc(cc3C=NO)C(F)(F)F)cc2[B]1(O)O |
|
Formula | C17 H18 B F3 N3 O6 S |
Name | (~{N}~{E})-~{N}-[[2-[[2-ethylsulfonyl-1,1-bis(oxidanyl)-3,4-dihydro-2,3,1$l^{4}-benzodiazaborinin-7-yl]oxy]-5-(trifluoromethyl)phenyl]methylidene]hydroxylamine |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5vrl Chain A Residue 300
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
Y161 K168 |
Catalytic site (residue number reindexed from 1) |
Y157 K164 |
Enzyme Commision number |
1.3.1.9: enoyl-[acyl-carrier-protein] reductase (NADH). |
|
|
|