Structure of PDB 5vee Chain A Binding Site BS01 |
|
|
Ligand ID | 981 |
InChI | InChI=1S/C25H23Cl2FN6O/c1-2-34-23-15(11-19(24(34)35)18-5-3-16(26)12-20(18)27)14-30-25(32-23)31-17-4-6-22(21(28)13-17)33-9-7-29-8-10-33/h3-6,11-14,29H,2,7-10H2,1H3,(H,30,31,32) |
InChIKey | DHKFOIHIUYFSOF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCN1C(=O)C(=Cc2cnc(Nc3ccc(N4CCNCC4)c(F)c3)nc12)c5ccc(Cl)cc5Cl | OpenEye OEToolkits 2.0.6 | CCN1c2c(cnc(n2)Nc3ccc(c(c3)F)N4CCNCC4)C=C(C1=O)c5ccc(cc5Cl)Cl | ACDLabs 12.01 | c1(ccc(c(c1)Cl)C=2C(=O)N(c3c(C=2)cnc(n3)Nc5cc(F)c(N4CCNCC4)cc5)CC)Cl |
|
Formula | C25 H23 Cl2 F N6 O |
Name | 6-(2,4-dichlorophenyl)-8-ethyl-2-{[3-fluoro-4-(piperazin-1-yl)phenyl]amino}pyrido[2,3-d]pyrimidin-7(8H)-one |
ChEMBL | CHEMBL3609326 |
DrugBank | |
ZINC | ZINC000095930185
|
PDB chain | 5vee Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|