Structure of PDB 5vc5 Chain A Binding Site BS01 |
|
|
Ligand ID | 96M |
InChI | InChI=1S/C26H27Cl2N5O2/c1-4-33(5-2)13-14-35-19-11-9-18(10-12-19)30-26-29-16-17-15-20(25(34)32(3)24(17)31-26)23-21(27)7-6-8-22(23)28/h6-12,15-16H,4-5,13-14H2,1-3H3,(H,29,30,31) |
InChIKey | IFPPYSWJNWHOLQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | CCN(CC)CCOc4ccc(Nc1ncc2c(n1)N(C(C(=C2)c3c(cccc3Cl)Cl)=O)C)cc4 | OpenEye OEToolkits 2.0.6 | CCN(CC)CCOc1ccc(cc1)Nc2ncc3c(n2)N(C(=O)C(=C3)c4c(cccc4Cl)Cl)C | CACTVS 3.385 | CCN(CC)CCOc1ccc(Nc2ncc3C=C(C(=O)N(C)c3n2)c4c(Cl)cccc4Cl)cc1 |
|
Formula | C26 H27 Cl2 N5 O2 |
Name | 6-(2,6-dichlorophenyl)-2-({4-[2-(diethylamino)ethoxy]phenyl}amino)-8-methylpyrido[2,3-d]pyrimidin-7(8H)-one |
ChEMBL | CHEMBL49120 |
DrugBank | |
ZINC | ZINC000001486219
|
PDB chain | 5vc5 Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D426 K428 |
Catalytic site (residue number reindexed from 1) |
D134 K136 |
Enzyme Commision number |
2.7.10.2: non-specific protein-tyrosine kinase. |
|
|
|