Structure of PDB 5uzj Chain A Binding Site BS01 |
|
|
Ligand ID | 8UV |
InChI | InChI=1S/C17H16N4O2S/c1-23-13-4-2-3-11(7-13)8-16(22)21-17-20-14(10-24-17)12-5-6-19-15(18)9-12/h2-7,9-10H,8H2,1H3,(H2,18,19)(H,20,21,22) |
InChIKey | HIGGJLMBFDDVKA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | COc1cccc(c1)CC(=O)Nc2nc(cs2)c3ccnc(c3)N | ACDLabs 12.01 | COc3cccc(CC(Nc1nc(cs1)c2ccnc(c2)N)=O)c3 | CACTVS 3.385 | COc1cccc(CC(=O)Nc2scc(n2)c3ccnc(N)c3)c1 |
|
Formula | C17 H16 N4 O2 S |
Name | N-[4-(2-aminopyridin-4-yl)-1,3-thiazol-2-yl]-2-(3-methoxyphenyl)acetamide |
ChEMBL | CHEMBL3581140 |
DrugBank | |
ZINC | ZINC000113830260
|
PDB chain | 5uzj Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|