Structure of PDB 5upg Chain A Binding Site BS01 |
|
|
Ligand ID | 8GJ |
InChI | InChI=1S/C18H21FN2O6S/c1-18(17(23)20-24,28(3,25)26)7-9-21-8-6-12(10-16(21)22)14-5-4-13(27-2)11-15(14)19/h4-6,8,10-11,24H,7,9H2,1-3H3,(H,20,23)/t18-/m1/s1 |
InChIKey | DNVUWHWBCMGQLU-GOSISDBHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | C[C@@](CCN1C=CC(=CC1=O)c2ccc(cc2F)OC)(C(=O)NO)S(=O)(=O)C | ACDLabs 12.01 | C2(c1ccc(cc1F)OC)=CC(N(C=C2)CCC(C)(S(C)(=O)=O)C(NO)=O)=O | CACTVS 3.385 | COc1ccc(c(F)c1)C2=CC(=O)N(CC[C@](C)(C(=O)NO)[S](C)(=O)=O)C=C2 | OpenEye OEToolkits 2.0.6 | CC(CCN1C=CC(=CC1=O)c2ccc(cc2F)OC)(C(=O)NO)S(=O)(=O)C | CACTVS 3.385 | COc1ccc(c(F)c1)C2=CC(=O)N(CC[C](C)(C(=O)NO)[S](C)(=O)=O)C=C2 |
|
Formula | C18 H21 F N2 O6 S |
Name | (2R)-4-[4-(2-fluoro-4-methoxyphenyl)-2-oxopyridin-1(2H)-yl]-N-hydroxy-2-methyl-2-(methylsulfonyl)butanamide |
ChEMBL | CHEMBL2023402 |
DrugBank | |
ZINC | ZINC000072315409
|
PDB chain | 5upg Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.5.1.108: UDP-3-O-acyl-N-acetylglucosamine deacetylase. |
|
|
|