Structure of PDB 5ukf Chain A Binding Site BS01 |
|
|
Ligand ID | 8E1 |
InChI | InChI=1S/C16H12N4O3S2/c17-25(22,23)10-3-1-9(2-4-10)18-7-11-14-12(20-16(11)21)5-6-13-15(14)24-8-19-13/h1-8,18H,(H,20,21)(H2,17,22,23)/b11-7- |
InChIKey | LTYGAJVXAFJKSY-XFFZJAGNSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1cc(ccc1NC=C2c3c(ccc4c3scn4)NC2=O)S(=O)(=O)N | CACTVS 3.385 | N[S](=O)(=O)c1ccc(NC=C2C(=O)Nc3ccc4ncsc4c23)cc1 | CACTVS 3.385 | N[S](=O)(=O)c1ccc(N\C=C\2C(=O)Nc3ccc4ncsc4c\23)cc1 | OpenEye OEToolkits 2.0.6 | c1cc(ccc1N/C=C\2/c3c(ccc4c3scn4)NC2=O)S(=O)(=O)N | ACDLabs 12.01 | c1cc(ccc1S(=O)(=O)N)N\C=C4\c2c(ccc3ncsc23)NC4=O |
|
Formula | C16 H12 N4 O3 S2 |
Name | 4-{[(Z)-(7-oxo-6,7-dihydro-8H-[1,3]thiazolo[5,4-e]indol-8-ylidene)methyl]amino}benzene-1-sulfonamide |
ChEMBL | CHEMBL271595 |
DrugBank | |
ZINC | ZINC000013470481
|
PDB chain | 5ukf Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.11.1: non-specific serine/threonine protein kinase. |
|
|
|