Structure of PDB 5u8a Chain A Binding Site BS01 |
|
|
Ligand ID | 82D |
InChI | InChI=1S/C22H25BrFN3/c1-25(2)22-14-27(13-18-19(23)8-6-9-20(18)24)12-17(22)16-11-26(3)21-10-5-4-7-15(16)21/h4-11,17,22H,12-14H2,1-3H3/t17-,22+/m1/s1 |
InChIKey | ZNFRUVZPVKADAA-VGSWGCGISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN(C)[CH]1CN(C[CH]1c2cn(C)c3ccccc23)Cc4c(F)cccc4Br | CACTVS 3.385 | CN(C)[C@H]1CN(C[C@@H]1c2cn(C)c3ccccc23)Cc4c(F)cccc4Br | OpenEye OEToolkits 2.0.6 | Cn1cc(c2c1cccc2)[C@H]3CN(C[C@@H]3N(C)C)Cc4c(cccc4Br)F | OpenEye OEToolkits 2.0.6 | Cn1cc(c2c1cccc2)C3CN(CC3N(C)C)Cc4c(cccc4Br)F | ACDLabs 12.01 | c12c(cccc1)n(cc2C4CN(Cc3c(Br)cccc3F)CC4N(C)C)C |
|
Formula | C22 H25 Br F N3 |
Name | (3R,4S)-1-[(2-bromo-6-fluorophenyl)methyl]-N,N-dimethyl-4-(1-methyl-1H-indol-3-yl)pyrrolidin-3-amine |
ChEMBL | CHEMBL4075197 |
DrugBank | |
ZINC |
|
PDB chain | 5u8a Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|