Structure of PDB 5u7r Chain A Binding Site BS01 |
|
|
Ligand ID | 81G |
InChI | InChI=1S/C21H21FN4O2S/c1-12-15(11-23-26-12)17-10-16-18(29-17)19(27)25-21(24-16)8-6-20(28,7-9-21)13-2-4-14(22)5-3-13/h2-5,10-11,24,28H,6-9H2,1H3,(H,23,26)(H,25,27)/t20-,21+ |
InChIKey | NCRZDERILSVITP-OYRHEFFESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1[nH]ncc1c2sc3C(=O)N[C]4(CC[C](O)(CC4)c5ccc(F)cc5)Nc3c2 | ACDLabs 12.01 | n5ncc(c1sc4c(c1)NC2(CCC(CC2)(O)c3ccc(cc3)F)NC4=O)c5C | OpenEye OEToolkits 2.0.6 | Cc1c(cn[nH]1)c2cc3c(s2)C(=O)NC4(N3)CCC(CC4)(c5ccc(cc5)F)O | CACTVS 3.385 | Cc1[nH]ncc1c2sc3C(=O)N[C@]4(CC[C@@](O)(CC4)c5ccc(F)cc5)Nc3c2 |
|
Formula | C21 H21 F N4 O2 S |
Name | (1s,4s)-4-(4-fluorophenyl)-4-hydroxy-6'-(5-methyl-1H-pyrazol-4-yl)-1'H-spiro[cyclohexane-1,2'-thieno[3,2-d]pyrimidin]-4'(3'H)-one |
ChEMBL | CHEMBL4213805 |
DrugBank | |
ZINC |
|
PDB chain | 5u7r Chain A Residue 500
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|