Structure of PDB 5u6d Chain A Binding Site BS01 |
|
|
Ligand ID | 7XG |
InChI | InChI=1S/C25H30FN5O/c1-17-5-4-6-23(26)21(17)13-30-14-22(24(15-30)29(2)3)19-9-7-18(8-10-19)20-11-28-31(12-20)16-25(27)32/h4-12,22,24H,13-16H2,1-3H3,(H2,27,32)/t22-,24+/m1/s1 |
InChIKey | BHCIUNLNTMWBGM-VWNXMTODSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | Cc1cccc(c1CN2CC(C(C2)N(C)C)c3ccc(cc3)c4cnn(c4)CC(=O)N)F | OpenEye OEToolkits 2.0.6 | Cc1cccc(c1CN2C[C@@H]([C@H](C2)N(C)C)c3ccc(cc3)c4cnn(c4)CC(=O)N)F | CACTVS 3.385 | CN(C)[C@H]1CN(C[C@@H]1c2ccc(cc2)c3cnn(CC(N)=O)c3)Cc4c(C)cccc4F | ACDLabs 12.01 | c4cc(C)c(CN3CC(c1ccc(cc1)c2cnn(c2)CC(N)=O)C(C3)N(C)C)c(c4)F | CACTVS 3.385 | CN(C)[CH]1CN(C[CH]1c2ccc(cc2)c3cnn(CC(N)=O)c3)Cc4c(C)cccc4F |
|
Formula | C25 H30 F N5 O |
Name | 2-[4-(4-{(3S,4R)-4-(dimethylamino)-1-[(2-fluoro-6-methylphenyl)methyl]pyrrolidin-3-yl}phenyl)-1H-pyrazol-1-yl]acetamide |
ChEMBL | CHEMBL4068192 |
DrugBank | |
ZINC |
|
PDB chain | 5u6d Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|