Structure of PDB 5u3f Chain A Binding Site BS01 |
|
|
Ligand ID | 7TS |
InChI | InChI=1S/C11H14N3O7P/c1-6-10(15)8(3-13-9-5-20-14-11(9)16)7(2-12-6)4-21-22(17,18)19/h2,5,13,15H,3-4H2,1H3,(H,14,16)(H2,17,18,19) |
InChIKey | PXWFNGNWQUPGPJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | Cc1c(c(c(cn1)COP(=O)(O)O)CNC2=CONC2=O)O | CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c(CNC2=CONC2=O)c1O | ACDLabs 12.01 | n2c(C)c(O)c(CNC=1C(=O)NOC=1)c(c2)COP(O)(O)=O |
|
Formula | C11 H14 N3 O7 P |
Name | (5-hydroxy-6-methyl-4-{[(3-oxo-2,3-dihydro-1,2-oxazol-4-yl)amino]methyl}pyridin-3-yl)methyl dihydrogen phosphate |
ChEMBL | |
DrugBank | DB03097 |
ZINC | ZINC000002046808
|
PDB chain | 5u3f Chain A Residue 400
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
K204 |
Catalytic site (residue number reindexed from 1) |
K162 |
Enzyme Commision number |
2.6.1.42: branched-chain-amino-acid transaminase. |
|
|
|