Structure of PDB 5u11 Chain A Binding Site BS01 |
|
|
Ligand ID | 7PS |
InChI | InChI=1S/C8H10N6O2S/c1-10-3(15)2-17-8-11-4-5(13-8)12-7(9)14-6(4)16/h2H2,1H3,(H,10,15)(H4,9,11,12,13,14,16) |
InChIKey | MKEVUZQIEYSSFO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c21c(nc(SCC(=O)NC)n1)N=C(N)NC2=O | OpenEye OEToolkits 2.0.6 | CNC(=O)CSc1[nH]c2c(n1)C(=O)NC(=N2)N | CACTVS 3.385 | CNC(=O)CSc1[nH]c2N=C(N)NC(=O)c2n1 |
|
Formula | C8 H10 N6 O2 S |
Name | 2-[(2-amino-6-oxo-6,9-dihydro-1H-purin-8-yl)sulfanyl]-N-methylacetamide |
ChEMBL | CHEMBL3819615 |
DrugBank | |
ZINC | ZINC000653873799
|
PDB chain | 5u11 Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.5.1.15: dihydropteroate synthase. |
|
|
|