Structure of PDB 5ttu Chain A Binding Site BS01 |
|
|
Ligand ID | 7KV |
InChI | InChI=1S/C16H21N5O/c1-2-14(22)20-7-4-11-5-8-21(13(11)9-20)16-12-3-6-17-15(12)18-10-19-16/h3,6,10-11,13H,2,4-5,7-9H2,1H3,(H,17,18,19)/t11-,13-/m0/s1 |
InChIKey | ZXWSRKWKYQKIOB-AAEUAGOBSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCC(=O)N1CC[CH]2CCN([CH]2C1)c3ncnc4[nH]ccc34 | ACDLabs 12.01 | n2c1ncnc(c1cc2)N3CCC4C3CN(C(=O)CC)CC4 | OpenEye OEToolkits 2.0.6 | CCC(=O)N1CCC2CCN(C2C1)c3c4cc[nH]c4ncn3 | CACTVS 3.385 | CCC(=O)N1CC[C@H]2CCN([C@H]2C1)c3ncnc4[nH]ccc34 | OpenEye OEToolkits 2.0.6 | CCC(=O)N1CC[C@H]2CCN([C@H]2C1)c3c4cc[nH]c4ncn3 |
|
Formula | C16 H21 N5 O |
Name | 1-[(3aR,7aR)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)octahydro-6H-pyrrolo[2,3-c]pyridin-6-yl]propan-1-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905483
|
PDB chain | 5ttu Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|