Structure of PDB 5tts Chain A Binding Site BS01 |
|
|
Ligand ID | 7KU |
InChI | InChI=1S/C14H19N5O/c1-2-12(20)19-7-3-4-10(8-19)18-14-11-5-6-15-13(11)16-9-17-14/h5-6,9-10H,2-4,7-8H2,1H3,(H2,15,16,17,18)/t10-/m1/s1 |
InChIKey | HTWQEUNJZRNASZ-SNVBAGLBSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCC(=O)N1CCC[C@H](C1)Nc2ncnc3[nH]ccc23 | OpenEye OEToolkits 2.0.6 | CCC(=O)N1CCC[C@H](C1)Nc2c3cc[nH]c3ncn2 | CACTVS 3.385 | CCC(=O)N1CCC[CH](C1)Nc2ncnc3[nH]ccc23 | OpenEye OEToolkits 2.0.6 | CCC(=O)N1CCCC(C1)Nc2c3cc[nH]c3ncn2 | ACDLabs 12.01 | n3c2ncnc(NC1CCCN(C1)C(CC)=O)c2cc3 |
|
Formula | C14 H19 N5 O |
Name | 1-{(3R)-3-[(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl}propan-1-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905382
|
PDB chain | 5tts Chain A Residue 4000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|