Structure of PDB 5tr6 Chain A Binding Site BS01 |
|
|
Ligand ID | 7KG |
InChI | InChI=1S/C17H21FN6O/c1-24-8-9(6-21-24)15-13-10(7-20-17(13)25)14(18)16(23-15)22-12-5-3-2-4-11(12)19/h6,8,11-12H,2-5,7,19H2,1H3,(H,20,25)(H,22,23)/t11-,12+/m0/s1 |
InChIKey | MJHOMTRKVMKCNE-NWDGAFQWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cn1cc(cn1)c2nc(N[C@@H]3CCCC[C@@H]3N)c(F)c4CNC(=O)c24 | ACDLabs 12.01 | c1(cn(C)nc1)c2c4c(c(c(n2)NC3CCCCC3N)F)CNC4=O | OpenEye OEToolkits 2.0.6 | Cn1cc(cn1)c2c3c(c(c(n2)NC4CCCCC4N)F)CNC3=O | OpenEye OEToolkits 2.0.6 | Cn1cc(cn1)c2c3c(c(c(n2)N[C@@H]4CCCC[C@@H]4N)F)CNC3=O | CACTVS 3.385 | Cn1cc(cn1)c2nc(N[CH]3CCCC[CH]3N)c(F)c4CNC(=O)c24 |
|
Formula | C17 H21 F N6 O |
Name | 6-{[(1R,2S)-2-aminocyclohexyl]amino}-7-fluoro-4-(1-methyl-1H-pyrazol-4-yl)-1,2-dihydro-3H-pyrrolo[3,4-c]pyridin-3-one |
ChEMBL | CHEMBL3979920 |
DrugBank | DB16849 |
ZINC |
|
PDB chain | 5tr6 Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|