Structure of PDB 5toz Chain A Binding Site BS01 |
|
|
Ligand ID | 7H4 |
InChI | InChI=1S/C15H21N5O/c1-3-13(21)20-8-11(5-4-10(20)2)19-15-12-6-7-16-14(12)17-9-18-15/h6-7,9-11H,3-5,8H2,1-2H3,(H2,16,17,18,19)/t10-,11+/m0/s1 |
InChIKey | VCTGEVNTYUYDAZ-WDEREUQCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCC(=O)N1CC(CCC1C)Nc2c3cc[nH]c3ncn2 | OpenEye OEToolkits 2.0.6 | CCC(=O)N1C[C@@H](CC[C@@H]1C)Nc2c3cc[nH]c3ncn2 | CACTVS 3.385 | CCC(=O)N1C[C@@H](CC[C@@H]1C)Nc2ncnc3[nH]ccc23 | ACDLabs 12.01 | n3c2c(c(NC1CCC(C)N(C(=O)CC)C1)ncn2)cc3 | CACTVS 3.385 | CCC(=O)N1C[CH](CC[CH]1C)Nc2ncnc3[nH]ccc23 |
|
Formula | C15 H21 N5 O |
Name | 1-{(2S,5R)-2-methyl-5-[(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl}propan-1-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905457
|
PDB chain | 5toz Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|