Structure of PDB 5tob Chain A Binding Site BS01 |
|
|
Ligand ID | YAM |
InChI | InChI=1S/C21H20F3N7O3S/c1-31(35(2,33)34)19-12(4-3-7-25-19)10-26-18-15(21(22,23)24)11-27-20(30-18)28-14-5-6-16-13(8-14)9-17(32)29-16/h3-8,11H,9-10H2,1-2H3,(H,29,32)(H2,26,27,28,30) |
InChIKey | MZDKLVOWGIOKTN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CN(c1ncccc1CNc2nc(Nc3ccc4NC(=O)Cc4c3)ncc2C(F)(F)F)[S](C)(=O)=O | OpenEye OEToolkits 1.5.0 | CN(c1c(cccn1)CNc2c(cnc(n2)Nc3ccc4c(c3)CC(=O)N4)C(F)(F)F)S(=O)(=O)C | ACDLabs 10.04 | O=S(=O)(N(c1ncccc1CNc2nc(ncc2C(F)(F)F)Nc3cc4c(cc3)NC(=O)C4)C)C |
|
Formula | C21 H20 F3 N7 O3 S |
Name | N-methyl-N-{3-[({2-[(2-oxo-2,3-dihydro-1H-indol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl}amino)methyl]pyridin-2-yl}methanesulfonamide |
ChEMBL | CHEMBL1084546 |
DrugBank | |
ZINC | ZINC000034638188
|
PDB chain | 5tob Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|