Structure of PDB 5tiu Chain A Binding Site BS01 |
|
|
Ligand ID | 7CU |
InChI | InChI=1S/C16H18N6O/c1-9(17)7-19-13-8-20-15(16(18)23)14(22-13)12-6-10-4-2-3-5-11(10)21-12/h2-6,8-9,21H,7,17H2,1H3,(H2,18,23)(H,19,22)/t9-/m0/s1 |
InChIKey | NYYIGJQYEWZYJP-VIFPVBQESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | C[C@@H](CNc1cnc(c(n1)c2cc3ccccc3[nH]2)C(=O)N)N | CACTVS 3.385 | C[CH](N)CNc1cnc(C(N)=O)c(n1)c2[nH]c3ccccc3c2 | CACTVS 3.385 | C[C@H](N)CNc1cnc(C(N)=O)c(n1)c2[nH]c3ccccc3c2 | ACDLabs 12.01 | c1(ncc(nc1c2cc3c(n2)cccc3)NCC(C)N)C(=O)N | OpenEye OEToolkits 2.0.6 | CC(CNc1cnc(c(n1)c2cc3ccccc3[nH]2)C(=O)N)N |
|
Formula | C16 H18 N6 O |
Name | 5-{[(2S)-2-aminopropyl]amino}-3-(1H-indol-2-yl)pyrazine-2-carboxamide |
ChEMBL | CHEMBL3951922 |
DrugBank | |
ZINC | ZINC000584905415
|
PDB chain | 5tiu Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|