Structure of PDB 5t68 Chain A Binding Site BS01 |
|
|
Ligand ID | 77V |
InChI | InChI=1S/C17H16N6O/c1-9-12-5-4-11(8-14(12)23-22-9)19-17-20-13-6-7-24-15(13)16(21-17)18-10-2-3-10/h4-8,10H,2-3H2,1H3,(H,22,23)(H2,18,19,20,21) |
InChIKey | MDWXVGCLSBQVMP-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | Cc1c2ccc(cc2[nH]n1)Nc3nc4ccoc4c(n3)NC5CC5 | CACTVS 3.385 | Cc1n[nH]c2cc(Nc3nc(NC4CC4)c5occc5n3)ccc12 | ACDLabs 12.01 | c1cc(cc2c1c(C)nn2)Nc4nc3ccoc3c(n4)NC5CC5 |
|
Formula | C17 H16 N6 O |
Name | N~4~-cyclopropyl-N~2~-(3-methyl-1H-indazol-6-yl)furo[3,2-d]pyrimidine-2,4-diamine |
ChEMBL | CHEMBL4062803 |
DrugBank | |
ZINC | ZINC000116903664
|
PDB chain | 5t68 Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|