Structure of PDB 5t1u Chain A Binding Site BS01 |
|
|
Ligand ID | P6U |
InChI | InChI=1S/C16H18F5N3S/c1-14(4-5-25-13(22)24-14)10-6-9(11(17)7-12(10)18)8-23-15(2-3-15)16(19,20)21/h6-7,23H,2-5,8H2,1H3,(H2,22,24)/t14-/m0/s1 |
InChIKey | XKONRMXLBXCJAM-AWEZNQCLSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[C@]1(CCSC(=N1)N)c2cc(CNC3(CC3)C(F)(F)F)c(F)cc2F | ACDLabs 12.01 OpenEye OEToolkits 2.0.5 | CC1(CCSC(=N1)N)c2cc(c(cc2F)F)CNC3(CC3)C(F)(F)F | CACTVS 3.385 | C[C]1(CCSC(=N1)N)c2cc(CNC3(CC3)C(F)(F)F)c(F)cc2F | OpenEye OEToolkits 2.0.5 | C[C@]1(CCSC(=N1)N)c2cc(c(cc2F)F)CNC3(CC3)C(F)(F)F |
|
Formula | C16 H18 F5 N3 S |
Name | (4S)-4-[2,4-difluoro-5-({[1-(trifluoromethyl)cyclopropyl]amino}methyl)phenyl]-4-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine |
ChEMBL | CHEMBL4098403 |
DrugBank | |
ZINC | ZINC000584905685
|
PDB chain | 5t1u Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|