Structure of PDB 5t18 Chain A Binding Site BS01 |
|
|
|
| Ligand ID | 73T |
| InChI | InChI=1S/C32H30F2N4O4/c1-15-17(7-6-10-24(15)38-30(40)19-8-5-9-21(33)28(19)37(4)31(38)41)25-22(34)14-20(29(35)39)27-26(25)18-12-11-16(32(2,3)42)13-23(18)36-27/h5-10,14,16,36,42H,11-13H2,1-4H3,(H2,35,39)/t16-/m0/s1 |
| InChIKey | ZRYMMWAJAFUANM-INIZCTEOSA-N |
| SMILES | | Software | SMILES |
|---|
| CACTVS 3.385 | CN1C(=O)N(C(=O)c2cccc(F)c12)c3cccc(c3C)c4c(F)cc(C(N)=O)c5[nH]c6C[CH](CCc6c45)C(C)(C)O | | OpenEye OEToolkits 2.0.5 | Cc1c(cccc1N2C(=O)c3cccc(c3N(C2=O)C)F)c4c(cc(c5c4c6c([nH]5)CC(CC6)C(C)(C)O)C(=O)N)F | | OpenEye OEToolkits 2.0.5 | Cc1c(cccc1N2C(=O)c3cccc(c3N(C2=O)C)F)c4c(cc(c5c4c6c([nH]5)C[C@H](CC6)C(C)(C)O)C(=O)N)F | | ACDLabs 12.01 | C6c5c4c(c(C(N)=O)cc(c4c1cccc(c1C)N3C(=O)N(C)c2c(cccc2F)C3=O)F)nc5CC(C6)C(C)(O)C | | CACTVS 3.385 | CN1C(=O)N(C(=O)c2cccc(F)c12)c3cccc(c3C)c4c(F)cc(C(N)=O)c5[nH]c6C[C@H](CCc6c45)C(C)(C)O |
|
| Formula | C32 H30 F2 N4 O4 |
| Name | 6-Fluoro-5-(R)-(3-(S)-(8-fluoro-1-methyl-2,4-dioxo-1,2-dihydroquinazolin-3(4H)-yl)-2-methylphenyl)-2-(S)-(2-hydroxypropan-2-yl)-2,3,4,9-tetrahydro-1H-carbazole-8-carboxamide;
(2S)-6-fluoro-5-[3-(8-fluoro-1-methyl-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl)-2-methylphenyl]-2-(2-hydroxypropan-2-yl)-2,3,4,9-tetrahydro-1H-carbazole-8-carboxamide |
| ChEMBL | CHEMBL3900554 |
| DrugBank | DB15291 |
| ZINC | ZINC000222995022
|
| PDB chain | 5t18 Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
| Global view | Local view | Structure summary |
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
| PDB | 5t18 Discovery of 6-Fluoro-5-(R)-(3-(S)-(8-fluoro-1-methyl-2,4-dioxo-1,2-dihydroquinazolin-3(4H)-yl)-2-methylphenyl)-2-(S)-(2-hydroxypropan-2-yl)-2,3,4,9-tetrahydro-1H-carbazole-8-carboxamide (BMS-986142): A Reversible Inhibitor of Bruton's Tyrosine Kinase (BTK) Conformationally Constrained by Two Locked Atropisomers. |
| Resolution | 1.5 Å |
Binding residue
(original residue number in PDB) | T410 V416 A428 K430 Y476 M477 A478 G480 C481 N484 R525 L528 |
Binding residue
(residue number reindexed from 1) | T17 V23 A35 K37 Y83 M84 A85 G87 C88 N91 R128 L131 |
| Annotation score | 1  |
| Binding affinity | MOAD: ic50=0.5nM
PDBbind-CN: -logKd/Ki=9.30,Kd=0.5nM
BindingDB: IC50=0.410nM |
|
|
|
|
|
|
|
|
