Structure of PDB 5t0p Chain A Binding Site BS01 |
|
|
Ligand ID | 73A |
InChI | InChI=1S/C22H23ClN6O2/c1-13(2)28-22(30)15(11-24)10-17-18(14-4-6-16(23)7-5-14)19-20(25)26-12-27-21(19)29(17)8-9-31-3/h4-7,10,12-13H,8-9H2,1-3H3,(H,28,30)(H2,25,26,27)/b15-10+ |
InChIKey | VJGVUTLADNGMJV-XNTDXEJSSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c21ncnc(c1c(c(/C=C(/C(NC(C)C)=O)C#N)n2CCOC)c3ccc(cc3)Cl)N | OpenEye OEToolkits 2.0.5 | CC(C)NC(=O)C(=Cc1c(c2c(ncnc2n1CCOC)N)c3ccc(cc3)Cl)C#N | CACTVS 3.385 | COCCn1c(\C=C(/C#N)C(=O)NC(C)C)c(c2ccc(Cl)cc2)c3c(N)ncnc13 | CACTVS 3.385 | COCCn1c(C=C(C#N)C(=O)NC(C)C)c(c2ccc(Cl)cc2)c3c(N)ncnc13 | OpenEye OEToolkits 2.0.5 | CC(C)NC(=O)/C(=C/c1c(c2c(ncnc2n1CCOC)N)c3ccc(cc3)Cl)/C#N |
|
Formula | C22 H23 Cl N6 O2 |
Name | (2E)-3-[4-amino-5-(4-chlorophenyl)-7-(2-methoxyethyl)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-2-cyano-N-(propan-2-yl)prop-2-enamide; Rao-IV-151, unbound form |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5t0p Chain A Residue 600
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|