Structure of PDB 5sy3 Chain A Binding Site BS01 |
|
|
Ligand ID | 74Z |
InChI | InChI=1S/C15H15N3OS/c1-2-6-12-11(5-1)13-14(17-9-18-15(13)20-12)16-8-10-4-3-7-19-10/h3-4,7,9H,1-2,5-6,8H2,(H,16,17,18) |
InChIKey | OZBAWCPXMIEVSW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.5 | c1cc(oc1)CNc2c3c4c(sc3ncn2)CCCC4 | ACDLabs 12.01 | c1nc(c2c(n1)sc3CCCCc23)NCc4ccco4 | CACTVS 3.385 | C1CCc2c(C1)sc3ncnc(NCc4occc4)c23 |
|
Formula | C15 H15 N3 O S |
Name | N-[(furan-2-yl)methyl]-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-amine |
ChEMBL | CHEMBL3915117 |
DrugBank | |
ZINC | ZINC000000364359
|
PDB chain | 5sy3 Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|