Structure of PDB 5suw Chain A Binding Site BS01 |
|
|
Ligand ID | 70G |
InChI | InChI=1S/C14H18O2/c1-10-4-2-5-11-6-3-7-12(14(10)11)8-9-13(15)16/h2,4-5,12H,3,6-9H2,1H3,(H,15,16)/t12-/m1/s1 |
InChIKey | IAGVZFLDKNPTAP-GFCCVEGCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1cccc2CCC[CH](CCC(O)=O)c12 | OpenEye OEToolkits 2.0.5 | Cc1cccc2c1[C@H](CCC2)CCC(=O)O | CACTVS 3.385 | Cc1cccc2CCC[C@H](CCC(O)=O)c12 | ACDLabs 12.01 | C(C(O)=O)CC2c1c(C)cccc1CCC2 | OpenEye OEToolkits 2.0.5 | Cc1cccc2c1C(CCC2)CCC(=O)O |
|
Formula | C14 H18 O2 |
Name | 3-[(1R)-8-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]propanoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5suw Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|