Structure of PDB 5ssa Chain A Binding Site BS01 |
|
|
Ligand ID | RM6 |
InChI | InChI=1S/C15H16N2O3S/c18-14(19)5-9-3-10(4-9)7-17-15(20)12-6-11-1-2-21-13(11)8-16-12/h1-2,6,8-10H,3-5,7H2,(H,17,20)(H,18,19)/t9-,10- |
InChIKey | BFCQGZXJYIJBQN-MGCOHNPYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1csc2c1cc(nc2)C(=O)NCC3CC(C3)CC(=O)O | CACTVS 3.385 | OC(=O)C[CH]1C[CH](CNC(=O)c2cc3ccsc3cn2)C1 | CACTVS 3.385 | OC(=O)C[C@@H]1C[C@@H](CNC(=O)c2cc3ccsc3cn2)C1 | ACDLabs 12.01 | O=C(O)CC1CC(C1)CNC(=O)c1cc2ccsc2cn1 |
|
Formula | C15 H16 N2 O3 S |
Name | [(1r,3r)-3-{[(thieno[2,3-c]pyridine-5-carbonyl)amino]methyl}cyclobutyl]acetic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5ssa Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|