Structure of PDB 5sre Chain A Binding Site BS01 |
|
|
Ligand ID | R8R |
InChI | InChI=1S/C19H19FN4O2/c20-11-2-3-12-14(8-11)23-16-15(12)17(22-10-21-16)24-7-6-19(4-1-5-19)13(9-24)18(25)26/h2-3,8,10,13H,1,4-7,9H2,(H,25,26)(H,21,22,23)/t13-/m1/s1 |
InChIKey | BNVOKYLFRJDXFX-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)[C@H]1CN(CCC12CCC2)c3ncnc4[nH]c5cc(F)ccc5c34 | OpenEye OEToolkits 2.0.7 | c1cc2c(cc1F)[nH]c3c2c(ncn3)N4CCC5(CCC5)[C@H](C4)C(=O)O | CACTVS 3.385 | OC(=O)[CH]1CN(CCC12CCC2)c3ncnc4[nH]c5cc(F)ccc5c34 | OpenEye OEToolkits 2.0.7 | c1cc2c(cc1F)[nH]c3c2c(ncn3)N4CCC5(CCC5)C(C4)C(=O)O | ACDLabs 12.01 | O=C(O)C1CN(CCC21CCC2)c1ncnc2[NH]c3cc(F)ccc3c21 |
|
Formula | C19 H19 F N4 O2 |
Name | (5R)-7-(7-fluoro-9H-pyrimido[4,5-b]indol-4-yl)-7-azaspiro[3.5]nonane-5-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5sre Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|