Structure of PDB 5sph Chain A Binding Site BS01 |
|
|
Ligand ID | RZR |
InChI | InChI=1S/C19H19N3O4/c1-20-19(26)21-13-8-6-11(7-9-13)17(23)22-16-14-5-3-2-4-12(14)10-15(16)18(24)25/h2-9,15-16H,10H2,1H3,(H,22,23)(H,24,25)(H2,20,21,26)/t15-,16-/m0/s1 |
InChIKey | BAKOSBATOMEZBB-HOTGVXAUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CNC(=O)Nc1ccc(cc1)C(=O)N[CH]2[CH](Cc3ccccc23)C(O)=O | OpenEye OEToolkits 2.0.7 | CNC(=O)Nc1ccc(cc1)C(=O)NC2c3ccccc3CC2C(=O)O | OpenEye OEToolkits 2.0.7 | CNC(=O)Nc1ccc(cc1)C(=O)N[C@H]2c3ccccc3C[C@@H]2C(=O)O | CACTVS 3.385 | CNC(=O)Nc1ccc(cc1)C(=O)N[C@@H]2[C@H](Cc3ccccc23)C(O)=O | ACDLabs 12.01 | CNC(=O)Nc1ccc(cc1)C(=O)NC1c2ccccc2CC1C(=O)O |
|
Formula | C19 H19 N3 O4 |
Name | (1R,2S)-1-[4-(methylcarbamamido)benzamido]-2,3-dihydro-1H-indene-2-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5sph Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|