Structure of PDB 5sp3 Chain A Binding Site BS01 |
|
|
Ligand ID | WYJ |
InChI | InChI=1S/C16H18N4O2/c1-10-6-20(7-11(8-21)22-10)16-14-12-4-2-3-5-13(12)19-15(14)17-9-18-16/h2-5,9-11,21H,6-8H2,1H3,(H,17,18,19)/t10-,11+/m1/s1 |
InChIKey | SSHCMXMCAMBDLI-MNOVXSKESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC1CN(CC(O1)CO)c2c3c4ccccc4[nH]c3ncn2 | OpenEye OEToolkits 2.0.7 | C[C@@H]1CN(C[C@H](O1)CO)c2c3c4ccccc4[nH]c3ncn2 | CACTVS 3.385 | C[CH]1CN(C[CH](CO)O1)c2ncnc3[nH]c4ccccc4c23 | ACDLabs 12.01 | c4cc2c(c1c(ncnc1n2)N3CC(C)OC(CO)C3)cc4 | CACTVS 3.385 | C[C@@H]1CN(C[C@@H](CO)O1)c2ncnc3[nH]c4ccccc4c23 |
|
Formula | C16 H18 N4 O2 |
Name | [(2S,6R)-6-methyl-4-(9H-pyrimido[4,5-b]indol-4-yl)morpholin-2-yl]methanol |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5sp3 Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|