Structure of PDB 5soq Chain A Binding Site BS01 |
|
|
Ligand ID | WWJ |
InChI | InChI=1S/C17H22N6O/c1-3-13-8-18-16-15(13)17(20-10-19-16)23-6-4-5-12(9-23)7-14-21-11(2)22-24-14/h8,10,12H,3-7,9H2,1-2H3,(H,18,19,20)/t12-/m1/s1 |
InChIKey | AUNHHPCCLQISEV-GFCCVEGCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CCc1c[nH]c2c1c(ncn2)N3CCC[C@@H](C3)Cc4nc(no4)C | CACTVS 3.385 | CCc1c[nH]c2ncnc(N3CCC[CH](C3)Cc4onc(C)n4)c12 | ACDLabs 12.01 | c1(ncnc2c1c(CC)cn2)N3CCCC(C3)Cc4nc(C)no4 | CACTVS 3.385 | CCc1c[nH]c2ncnc(N3CCC[C@@H](C3)Cc4onc(C)n4)c12 | OpenEye OEToolkits 2.0.7 | CCc1c[nH]c2c1c(ncn2)N3CCCC(C3)Cc4nc(no4)C |
|
Formula | C17 H22 N6 O |
Name | 5-ethyl-4-{(3R)-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperidin-1-yl}-7H-pyrrolo[2,3-d]pyrimidine |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5soq Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|