Structure of PDB 5som Chain A Binding Site BS01 |
|
|
Ligand ID | WVY |
InChI | InChI=1S/C17H19N3O3/c21-16(23-12-14-3-1-8-18-17(14)22)11-13-4-6-15(7-5-13)20-10-2-9-19-20/h2,4-7,9-10,14H,1,3,8,11-12H2,(H,18,22)/t14-/m0/s1 |
InChIKey | BBSKBVDQKLCENN-AWEZNQCLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1cnn(c1)c2ccc(cc2)CC(=O)OC[C@@H]3CCCNC3=O | CACTVS 3.385 | O=C(Cc1ccc(cc1)n2cccn2)OC[C@@H]3CCCNC3=O | ACDLabs 12.01 | c3nn(c2ccc(CC(OCC1C(NCCC1)=O)=O)cc2)cc3 | CACTVS 3.385 | O=C(Cc1ccc(cc1)n2cccn2)OC[CH]3CCCNC3=O | OpenEye OEToolkits 2.0.7 | c1cnn(c1)c2ccc(cc2)CC(=O)OCC3CCCNC3=O |
|
Formula | C17 H19 N3 O3 |
Name | [(3S)-2-oxopiperidin-3-yl]methyl [4-(1H-pyrazol-1-yl)phenyl]acetate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5som Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|