Structure of PDB 5soi Chain A Binding Site BS01 |
|
|
Ligand ID | WVG |
InChI | InChI=1S/C14H18N4O2/c19-12(20)4-3-10-2-1-7-18(8-10)14-11-5-6-15-13(11)16-9-17-14/h5-6,9-10H,1-4,7-8H2,(H,19,20)(H,15,16,17)/t10-/m1/s1 |
InChIKey | ADFCTPSWZLLXQI-SNVBAGLBSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1c[nH]c2c1c(ncn2)N3CCCC(C3)CCC(=O)O | OpenEye OEToolkits 2.0.7 | c1c[nH]c2c1c(ncn2)N3CCC[C@@H](C3)CCC(=O)O | CACTVS 3.385 | OC(=O)CC[CH]1CCCN(C1)c2ncnc3[nH]ccc23 | ACDLabs 12.01 | c21c(ncc1)ncnc2N3CCCC(CCC(O)=O)C3 | CACTVS 3.385 | OC(=O)CC[C@H]1CCCN(C1)c2ncnc3[nH]ccc23 |
|
Formula | C14 H18 N4 O2 |
Name | 3-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]propanoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5soi Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|