Structure of PDB 5s8z Chain A Binding Site BS01 |
|
|
Ligand ID | Y1M |
InChI | InChI=1S/C15H21N3O3S/c19-14(13-4-1-9-21-13)17-5-7-18(8-6-17)15(20)16-11-12-3-2-10-22-12/h1,4,9,22H,2-3,5-8,10-11H2,(H,16,20) |
InChIKey | NPFSQHMDDIVZSU-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1cc(oc1)C(=O)N2CCN(CC2)C(=O)NCC3=SCCC3 | CACTVS 3.385 | O=C(NCC1=[SH]CCC1)N2CCN(CC2)C(=O)c3occc3 | ACDLabs 12.01 | N2(CCN(C(=O)c1ccco1)CC2)C(NCC=3CCCS=3)=O |
|
Formula | C15 H21 N3 O3 S |
Name | N-[(3,4-dihydro-2H-1lambda~4~-thiophen-5-yl)methyl]-4-(furan-2-carbonyl)piperazine-1-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5s8z Chain A Residue 1501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|