Structure of PDB 5s3j Chain A Binding Site BS01 |
|
|
Ligand ID | W1S |
InChI | InChI=1S/C8H11N3O/c9-7(12)6-2-1-4-11-5-3-10-8(6)11/h3,5-6H,1-2,4H2,(H2,9,12)/t6-/m1/s1 |
InChIKey | VSXNZKCCQSDVAD-ZCFIWIBFSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | NC(=O)[CH]1CCCn2ccnc12 | CACTVS 3.385 | NC(=O)[C@H]1CCCn2ccnc12 | ACDLabs 12.01 | n21CCCC(c1ncc2)C(=O)N | OpenEye OEToolkits 2.0.7 | c1cn2c(n1)C(CCC2)C(=O)N | OpenEye OEToolkits 2.0.7 | c1cn2c(n1)[C@H](CCC2)C(=O)N |
|
Formula | C8 H11 N3 O |
Name | (8S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-8-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000075772338
|
PDB chain | 5s3j Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|