Structure of PDB 5r53 Chain A Binding Site BS01 |
|
|
Ligand ID | RYG |
InChI | InChI=1S/C11H14N2O3/c14-10-8(4-1-2-6-12-10)13-11(15)9-5-3-7-16-9/h3,5,7-8H,1-2,4,6H2,(H,12,14)(H,13,15)/t8-/m1/s1 |
InChIKey | KMCPPIBDTMYPRI-MRVPVSSYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1cc(oc1)C(=O)N[C@@H]2CCCCNC2=O | OpenEye OEToolkits 2.0.6 | c1cc(oc1)C(=O)NC2CCCCNC2=O | CACTVS 3.385 | O=C1NCCCC[C@H]1NC(=O)c2occc2 | CACTVS 3.385 | O=C1NCCCC[CH]1NC(=O)c2occc2 |
|
Formula | C11 H14 N2 O3 |
Name | ~{N}-[(3~{R})-2-oxidanylideneazepan-3-yl]furan-2-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000000153520
|
PDB chain | 5r53 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.6.1.45: UDP-sugar diphosphatase. |
|
|
|