Structure of PDB 5r4e Chain A Binding Site BS01 |
|
|
Ligand ID | RQP |
InChI | InChI=1S/C15H19FN2O4/c1-22-9-7-18-13(20)15(6-8-19,17-14(18)21)10-11-2-4-12(16)5-3-11/h2-5,19H,6-10H2,1H3,(H,17,21)/t15-/m0/s1 |
InChIKey | LEFBUGONDDVZFX-HNNXBMFYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COCCN1C(=O)N[C](CCO)(Cc2ccc(F)cc2)C1=O | OpenEye OEToolkits 2.0.6 | COCCN1C(=O)[C@](NC1=O)(CCO)Cc2ccc(cc2)F | CACTVS 3.385 | COCCN1C(=O)N[C@@](CCO)(Cc2ccc(F)cc2)C1=O | OpenEye OEToolkits 2.0.6 | COCCN1C(=O)C(NC1=O)(CCO)Cc2ccc(cc2)F | ACDLabs 12.01 | C(C2(Cc1ccc(cc1)F)C(=O)N(CCOC)C(N2)=O)CO |
|
Formula | C15 H19 F N2 O4 |
Name | (5R)-5-[(4-fluorophenyl)methyl]-5-(2-hydroxyethyl)-3-(2-methoxyethyl)imidazolidine-2,4-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5r4e Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|