Structure of PDB 5qbf Chain A Binding Site BS01 |
|
|
Ligand ID | D8J |
InChI | InChI=1S/C12H15FN2O3/c13-8-3-1-7(2-4-8)12(17)15-5-10-11(16)9(14)6-18-10/h1-4,9-11,16H,5-6,14H2,(H,15,17)/t9-,10-,11+/m1/s1 |
InChIKey | FDPRGBDPIJLPIW-MXWKQRLJSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | N[CH]1CO[CH](CNC(=O)c2ccc(F)cc2)[CH]1O | CACTVS 3.385 | N[C@@H]1CO[C@H](CNC(=O)c2ccc(F)cc2)[C@H]1O | ACDLabs 12.01 | c1cc(F)ccc1C(=O)NCC2C(O)C(N)CO2 | OpenEye OEToolkits 2.0.6 | c1cc(ccc1C(=O)NC[C@@H]2[C@H]([C@@H](CO2)N)O)F | OpenEye OEToolkits 2.0.6 | c1cc(ccc1C(=O)NCC2C(C(CO2)N)O)F |
|
Formula | C12 H15 F N2 O3 |
Name | 2-amino-1,4-anhydro-2,5-dideoxy-5-[(4-fluorobenzene-1-carbonyl)amino]-D-arabinitol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000078931563
|
PDB chain | 5qbf Chain A Residue 405
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|